About 2,5-bis[(5-acetyl-4,7-dimethoxy-1-benzofuran-6-yl)oxymethyl]benzoic acid
2,5-bis[(5-acetyl-4,7-dimethoxy-1-benzofuran-6-yl)oxymethyl]benzoic acid (PubChem CID 11169502) has the molecular formula C33H30O12
and a molecular weight of 618.59 g/mol. Its IUPAC name is 2,5-bis[(5-acetyl-4,7-dimethoxy-1-benzofuran-6-yl)oxymethyl]benzoic acid.
Molecular Properties
| Compound Name | 2,5-bis[(5-acetyl-4,7-dimethoxy-1-benzofuran-6-yl)oxymethyl]benzoic acid |
| PubChem CID | 11169502 |
| Molecular Formula | C33H30O12 |
| Molecular Weight | 618.59 g/mol |
| Exact Mass | 618.17 |
| IUPAC Name | 2,5-bis[(5-acetyl-4,7-dimethoxy-1-benzofuran-6-yl)oxymethyl]benzoic acid |
| SMILES | COc1c(C(C)=O)c(OCc2ccc(COc3c(C(C)=O)c(OC)c4ccoc4c3OC)c(C(=O)O)c2)c(OC)c2occc12 |
| InChI | InChI=1S/C33H30O12/c1-16(34)23-25(38-3)20-9-11-42-27(20)31(40-5)29(23)44-14-18-7-8-19(22(13-18)33(36)37)15-45-30-24(17(2)35)26(39-4)21-10-12-43-28(21)32(30)41-6/h7-13H,14-15H2,1-6H3,(H,36,37) |
| InChIKey | BRBOOKZIDBWXKB-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 153.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 618.59 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
Analyze 2,5-bis[(5-acetyl-4,7-dimethoxy-1-benzofuran-6-yl)oxymethyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis[(5-acetyl-4,7-dimethoxy-1-benzofuran-6-yl)oxymethyl]benzoic acid?
The IUPAC name of 2,5-bis[(5-acetyl-4,7-dimethoxy-1-benzofuran-6-yl)oxymethyl]benzoic acid (CID 11169502) is 2,5-bis[(5-acetyl-4,7-dimethoxy-1-benzofuran-6-yl)oxymethyl]benzoic acid.
What is the SMILES notation for 2,5-bis[(5-acetyl-4,7-dimethoxy-1-benzofuran-6-yl)oxymethyl]benzoic acid?
The canonical SMILES for 2,5-bis[(5-acetyl-4,7-dimethoxy-1-benzofuran-6-yl)oxymethyl]benzoic acid is COc1c(C(C)=O)c(OCc2ccc(COc3c(C(C)=O)c(OC)c4ccoc4c3OC)c(C(=O)O)c2)c(OC)c2occc12.
What is the InChIKey of 2,5-bis[(5-acetyl-4,7-dimethoxy-1-benzofuran-6-yl)oxymethyl]benzoic acid?
The InChIKey is BRBOOKZIDBWXKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H30O12/c1-16(34)23-25(38-3)20-9-11-42-27(20)31(40-5)29(23)44-14-18-7-8-19(22(13-18)33(36)37)15-45-30-24(17(2)35)26(39-4)21-10-12-43-28(21)32(30)41-6/h7-13H,14-15H2,1-6H3,(H,36,37).
What are the key properties of 2,5-bis[(5-acetyl-4,7-dimethoxy-1-benzofuran-6-yl)oxymethyl]benzoic acid?
2,5-bis[(5-acetyl-4,7-dimethoxy-1-benzofuran-6-yl)oxymethyl]benzoic acid has a molecular weight of 618.59 g/mol, XLogP of 6.47, 13 rotatable bonds, 1 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis[(5-acetyl-4,7-dimethoxy-1-benzofuran-6-yl)oxymethyl]benzoic acid is sourced from PubChem (CID 11169502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).