C27H17ClF8O4S — CID 11169550
[(2R,3S)-4-(4-chloro-1,1,2,2,3,3,4,4-octafluorobutyl)sulfonyl-3,5-diphenyl-2,3-dihydrofuran-2-yl]-phenylmethanone (PubChem CID 11169550) has the molecular formula C27H17ClF8O4S and a molecular weight of 624.93 g/mol. Its IUPAC name is [(2R,3S)-4-(4-chloro-1,1,2,2,3,3,4,4-octafluorobutyl)sulfonyl-3,5-diphenyl-2,3-dihydrofuran-2-yl]-phenylmethanone.
| Compound Name | [(2R,3S)-4-(4-chloro-1,1,2,2,3,3,4,4-octafluorobutyl)sulfonyl-3,5-diphenyl-2,3-dihydrofuran-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 11169550 |
| Molecular Formula | C27H17ClF8O4S |
| Molecular Weight | 624.93 g/mol |
| Exact Mass | 624.04 |
| IUPAC Name | [(2R,3S)-4-(4-chloro-1,1,2,2,3,3,4,4-octafluorobutyl)sulfonyl-3,5-diphenyl-2,3-dihydrofuran-2-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@@H]1OC(c2ccccc2)=C(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C27H17ClF8O4S/c28-26(33,34)24(29,30)25(31,32)27(35,36)41(38,39)23-19(16-10-4-1-5-11-16)22(20(37)17-12-6-2-7-13-17)40-21(23)18-14-8-3-9-15-18/h1-15,19,22H/t19-,22+/m0/s1 |
| InChIKey | DXNUEMMZDFSWFY-SIKLNZKXSA-N |
| XLogP | 7.53 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.93 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|