C10H14BrNO2S — CID 111695665
5-bromo-N-(3-hydroxybutyl)-N-methylthiophene-2-carboxamide (PubChem CID 111695665) has the molecular formula C10H14BrNO2S and a molecular weight of 292.20 g/mol. Its IUPAC name is 5-bromo-N-(3-hydroxybutyl)-N-methylthiophene-2-carboxamide.
| Compound Name | 5-bromo-N-(3-hydroxybutyl)-N-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 111695665 |
| Molecular Formula | C10H14BrNO2S |
| Molecular Weight | 292.20 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | 5-bromo-N-(3-hydroxybutyl)-N-methylthiophene-2-carboxamide |
| SMILES | CC(O)CCN(C)C(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C10H14BrNO2S/c1-7(13)5-6-12(2)10(14)8-3-4-9(11)15-8/h3-4,7,13H,5-6H2,1-2H3 |
| InChIKey | OBDKCDPNQSJHCA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.20 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |