C32H60O8Si2 — CID 11169579
2-[(2S,4S,6S,8R,10S)-10-acetyloxy-2-[(3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-methylidenebutyl]-4-methyl-4-triethylsilyloxy-1,7-dioxaspiro[5.5]undecan-8-yl]acetic acid (PubChem CID 11169579) has the molecular formula C32H60O8Si2 and a molecular weight of 629.00 g/mol. Its IUPAC name is 2-[(2S,4S,6S,8R,10S)-10-acetyloxy-2-[(3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-methylidenebutyl]-4-methyl-4-triethylsilyloxy-1,7-dioxaspiro[5.5]undecan-8-yl]acetic acid.
| Compound Name | 2-[(2S,4S,6S,8R,10S)-10-acetyloxy-2-[(3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-methylidenebutyl]-4-methyl-4-triethylsilyloxy-1,7-dioxaspiro[5.5]undecan-8-yl]acetic acid |
|---|---|
| PubChem CID | 11169579 |
| Molecular Formula | C32H60O8Si2 |
| Molecular Weight | 629.00 g/mol |
| Exact Mass | 628.38 |
| IUPAC Name | 2-[(2S,4S,6S,8R,10S)-10-acetyloxy-2-[(3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-methylidenebutyl]-4-methyl-4-triethylsilyloxy-1,7-dioxaspiro[5.5]undecan-8-yl]acetic acid |
| SMILES | C=C(C[C@H]1C[C@](C)(O[Si](CC)(CC)CC)C[C@@]2(C[C@@H](OC(C)=O)C[C@H](CC(=O)O)O2)O1)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H60O8Si2/c1-13-42(14-2,15-3)40-31(10)19-28(16-23(4)24(5)21-36-41(11,12)30(7,8)9)39-32(22-31)20-27(37-25(6)33)17-26(38-32)18-29(34)35/h24,26-28H,4,13-22H2,1-3,5-12H3,(H,34,35)/t24-,26+,27-,28-,31-,32+/m0/s1 |
| InChIKey | JYZIAIKHNFEZIT-MPFSDUNJSA-N |
| XLogP | 7.83 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.00 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|