C41H48N7+ — CID 11169647
6-phenyl-5-[3-[3-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propylamino]propylamino]propyl]phenanthridin-5-ium-3,8-diamine (PubChem CID 11169647) has the molecular formula C41H48N7+ and a molecular weight of 638.88 g/mol. Its IUPAC name is 6-phenyl-5-[3-[3-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propylamino]propylamino]propyl]phenanthridin-5-ium-3,8-diamine.
| Compound Name | 6-phenyl-5-[3-[3-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propylamino]propylamino]propyl]phenanthridin-5-ium-3,8-diamine |
|---|---|
| PubChem CID | 11169647 |
| Molecular Formula | C41H48N7+ |
| Molecular Weight | 638.88 g/mol |
| Exact Mass | 638.40 |
| IUPAC Name | 6-phenyl-5-[3-[3-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propylamino]propylamino]propyl]phenanthridin-5-ium-3,8-diamine |
| SMILES | Nc1ccc2c(c1)c(-c1ccccc1)[n+](CCCNCCCNCCCNc1c3c(nc4ccccc14)CCCC3)c1cc(N)ccc21 |
| InChI | InChI=1S/C41H47N7/c42-30-17-19-32-33-20-18-31(43)28-39(33)48(41(36(32)27-30)29-11-2-1-3-12-29)26-10-24-45-22-8-21-44-23-9-25-46-40-34-13-4-6-15-37(34)47-38-16-7-5-14-35(38)40/h1-4,6,11-13,15,17-20,27-28,43-45H,5,7-10,14,16,21-26,42H2,(H,46,47)/p+1 |
| InChIKey | UXTFWAJYDNDQIT-UHFFFAOYSA-O |
| XLogP | 7.00 |
| TPSA | 104.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.88 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|