C14H17N3O2 — CID 111696969
2-cyclopropyl-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]pyrimidine-4-carboxamide (PubChem CID 111696969) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-cyclopropyl-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]pyrimidine-4-carboxamide.
| Compound Name | 2-cyclopropyl-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 111696969 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 2-cyclopropyl-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]pyrimidine-4-carboxamide |
| SMILES | O=C(N[C@@H]1C=C[C@H](CO)C1)c1ccnc(C2CC2)n1 |
| InChI | InChI=1S/C14H17N3O2/c18-8-9-1-4-11(7-9)16-14(19)12-5-6-15-13(17-12)10-2-3-10/h1,4-6,9-11,18H,2-3,7-8H2,(H,16,19)/t9-,11+/m0/s1 |
| InChIKey | MSSAMPLYWVRHAB-GXSJLCMTSA-N |
| XLogP | 1.02 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|