C36H66O6Si2 — CID 11169734
[(3S,5Z)-6-methyl-2-oxonona-5,8-dien-3-yl] (3S,6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-4,4,6,8-tetramethyl-5-oxo-3-triethylsilyloxydec-9-enoate (PubChem CID 11169734) has the molecular formula C36H66O6Si2 and a molecular weight of 651.09 g/mol. Its IUPAC name is [(3S,5Z)-6-methyl-2-oxonona-5,8-dien-3-yl] (3S,6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-4,4,6,8-tetramethyl-5-oxo-3-triethylsilyloxydec-9-enoate.
| Compound Name | [(3S,5Z)-6-methyl-2-oxonona-5,8-dien-3-yl] (3S,6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-4,4,6,8-tetramethyl-5-oxo-3-triethylsilyloxydec-9-enoate |
|---|---|
| PubChem CID | 11169734 |
| Molecular Formula | C36H66O6Si2 |
| Molecular Weight | 651.09 g/mol |
| Exact Mass | 650.44 |
| IUPAC Name | [(3S,5Z)-6-methyl-2-oxonona-5,8-dien-3-yl] (3S,6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-4,4,6,8-tetramethyl-5-oxo-3-triethylsilyloxydec-9-enoate |
| SMILES | C=CC/C(C)=C\C[C@H](OC(=O)C[C@H](O[Si](CC)(CC)CC)C(C)(C)C(=O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C=C)C(C)=O |
| InChI | InChI=1S/C36H66O6Si2/c1-17-22-26(6)23-24-30(29(9)37)40-32(38)25-31(41-44(19-3,20-4)21-5)36(13,14)34(39)28(8)33(27(7)18-2)42-43(15,16)35(10,11)12/h17-18,23,27-28,30-31,33H,1-2,19-22,24-25H2,3-16H3/b26-23-/t27-,28+,30-,31-,33-/m0/s1 |
| InChIKey | FJPYSGZXYAYNPC-ZSGAJRNISA-N |
| XLogP | 9.62 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.09 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|