C39H62O5Si2 — CID 11169814
(3R,4S)-3,10-bis[[tert-butyl(dimethyl)silyl]oxy]-4,8,8-trimethyl-1,9-bis(phenylmethoxy)dec-6-yn-5-one (PubChem CID 11169814) has the molecular formula C39H62O5Si2 and a molecular weight of 667.09 g/mol. Its IUPAC name is (3R,4S)-3,10-bis[[tert-butyl(dimethyl)silyl]oxy]-4,8,8-trimethyl-1,9-bis(phenylmethoxy)dec-6-yn-5-one.
| Compound Name | (3R,4S)-3,10-bis[[tert-butyl(dimethyl)silyl]oxy]-4,8,8-trimethyl-1,9-bis(phenylmethoxy)dec-6-yn-5-one |
|---|---|
| PubChem CID | 11169814 |
| Molecular Formula | C39H62O5Si2 |
| Molecular Weight | 667.09 g/mol |
| Exact Mass | 666.41 |
| IUPAC Name | (3R,4S)-3,10-bis[[tert-butyl(dimethyl)silyl]oxy]-4,8,8-trimethyl-1,9-bis(phenylmethoxy)dec-6-yn-5-one |
| SMILES | C[C@H](C(=O)C#CC(C)(C)C(CO[Si](C)(C)C(C)(C)C)OCc1ccccc1)[C@@H](CCOCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C39H62O5Si2/c1-31(35(44-46(12,13)38(5,6)7)25-27-41-28-32-20-16-14-17-21-32)34(40)24-26-39(8,9)36(30-43-45(10,11)37(2,3)4)42-29-33-22-18-15-19-23-33/h14-23,31,35-36H,25,27-30H2,1-13H3/t31-,35-,36?/m1/s1 |
| InChIKey | OXIMCYXXPDMNNP-HKGUWHNTSA-N |
| XLogP | 9.83 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.09 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|