C28H52N5O12P — CID 11169895
methyl 2-[[(2S)-5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-2-diethoxyphosphorylacetate (PubChem CID 11169895) has the molecular formula C28H52N5O12P and a molecular weight of 681.72 g/mol. Its IUPAC name is methyl 2-[[(2S)-5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-2-diethoxyphosphorylacetate.
| Compound Name | methyl 2-[[(2S)-5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-2-diethoxyphosphorylacetate |
|---|---|
| PubChem CID | 11169895 |
| Molecular Formula | C28H52N5O12P |
| Molecular Weight | 681.72 g/mol |
| Exact Mass | 681.34 |
| IUPAC Name | methyl 2-[[(2S)-5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-2-diethoxyphosphorylacetate |
| SMILES | CCOP(=O)(OCC)C(NC(=O)[C@H](CCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C28H52N5O12P/c1-13-41-46(39,42-14-2)20(21(35)40-12)31-19(34)18(30-23(36)43-26(3,4)5)16-15-17-29-22(32-24(37)44-27(6,7)8)33-25(38)45-28(9,10)11/h18,20H,13-17H2,1-12H3,(H,30,36)(H,31,34)(H2,29,32,33,37,38)/t18-,20?/m0/s1 |
| InChIKey | GMLTXTOGXYMBEB-LROBGIAVSA-N |
| XLogP | 3.95 |
| TPSA | 218.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.72 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|