C23H40IN7O2 — CID 111699512
2-[[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]methyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111699512) has the molecular formula C23H40IN7O2 and a molecular weight of 573.52 g/mol. Its IUPAC name is 2-[[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]methyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]methyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111699512 |
| Molecular Formula | C23H40IN7O2 |
| Molecular Weight | 573.52 g/mol |
| Exact Mass | 573.23 |
| IUPAC Name | 2-[[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]methyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OCCN(CC)CC)c(OC)c1)NCCn1cnnc1CC.I |
| InChI | InChI=1S/C23H39N7O2.HI/c1-6-22-28-27-18-30(22)13-12-25-23(24-7-2)26-17-19-10-11-20(21(16-19)31-5)32-15-14-29(8-3)9-4;/h10-11,16,18H,6-9,12-15,17H2,1-5H3,(H2,24,25,26);1H |
| InChIKey | JURJTOOENQMFQC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.52 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|