C18H25IN8 — CID 111700236
1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methyl-3-[(1-phenylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111700236) has the molecular formula C18H25IN8 and a molecular weight of 480.36 g/mol. Its IUPAC name is 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methyl-3-[(1-phenylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methyl-3-[(1-phenylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111700236 |
| Molecular Formula | C18H25IN8 |
| Molecular Weight | 480.36 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methyl-3-[(1-phenylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCc1nncn1CCN/C(=N\C)NCc1cnn(-c2ccccc2)c1.I |
| InChI | InChI=1S/C18H24N8.HI/c1-3-17-24-22-14-25(17)10-9-20-18(19-2)21-11-15-12-23-26(13-15)16-7-5-4-6-8-16;/h4-8,12-14H,3,9-11H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | YKSQDWRYRSUUFD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|