C39H74O6Si3 — CID 11170068
ethyl (3E,6S,7S,8Z,10E,13R,15S)-7,13,15-tris[[tert-butyl(dimethyl)silyl]oxy]-6-methyl-17-oxocycloheptadeca-3,8,10-triene-1-carboxylate (PubChem CID 11170068) has the molecular formula C39H74O6Si3 and a molecular weight of 723.27 g/mol. Its IUPAC name is ethyl (3E,6S,7S,8Z,10E,13R,15S)-7,13,15-tris[[tert-butyl(dimethyl)silyl]oxy]-6-methyl-17-oxocycloheptadeca-3,8,10-triene-1-carboxylate.
| Compound Name | ethyl (3E,6S,7S,8Z,10E,13R,15S)-7,13,15-tris[[tert-butyl(dimethyl)silyl]oxy]-6-methyl-17-oxocycloheptadeca-3,8,10-triene-1-carboxylate |
|---|---|
| PubChem CID | 11170068 |
| Molecular Formula | C39H74O6Si3 |
| Molecular Weight | 723.27 g/mol |
| Exact Mass | 722.48 |
| IUPAC Name | ethyl (3E,6S,7S,8Z,10E,13R,15S)-7,13,15-tris[[tert-butyl(dimethyl)silyl]oxy]-6-methyl-17-oxocycloheptadeca-3,8,10-triene-1-carboxylate |
| SMILES | CCOC(=O)C1C/C=C/C[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)/C=C\C=C\C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)CC1=O |
| InChI | InChI=1S/C39H74O6Si3/c1-18-42-36(41)33-26-23-22-24-30(2)35(45-48(16,17)39(9,10)11)27-21-19-20-25-31(43-46(12,13)37(3,4)5)28-32(29-34(33)40)44-47(14,15)38(6,7)8/h19-23,27,30-33,35H,18,24-26,28-29H2,1-17H3/b20-19+,23-22+,27-21-/t30-,31+,32-,33?,35+/m0/s1 |
| InChIKey | QVFGVIUPDJDLQK-PXOMIVDSSA-N |
| XLogP | 11.17 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.27 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|