C22H34FIN6 — CID 111700858
1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[[1-(4-fluorophenyl)cyclohexyl]methyl]guanidine;hydroiodide (PubChem CID 111700858) has the molecular formula C22H34FIN6 and a molecular weight of 528.46 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[[1-(4-fluorophenyl)cyclohexyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[[1-(4-fluorophenyl)cyclohexyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111700858 |
| Molecular Formula | C22H34FIN6 |
| Molecular Weight | 528.46 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[[1-(4-fluorophenyl)cyclohexyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1(c2ccc(F)cc2)CCCCC1)NCCn1cnnc1CC.I |
| InChI | InChI=1S/C22H33FN6.HI/c1-3-20-28-27-17-29(20)15-14-25-21(24-4-2)26-16-22(12-6-5-7-13-22)18-8-10-19(23)11-9-18;/h8-11,17H,3-7,12-16H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | SVZSLVYMVGKJIL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|