C38H58N2O12 — CID 11170100
(1R,6R,7S,8R,9R,10R,15R,16S,17R,18R)-7,9,16,18-tetrakis(methoxymethoxy)-8,17-bis(phenylmethoxy)-19,20-dioxa-3,12-diazatricyclo[13.3.1.16,10]icosane (PubChem CID 11170100) has the molecular formula C38H58N2O12 and a molecular weight of 734.88 g/mol. Its IUPAC name is (1R,6R,7S,8R,9R,10R,15R,16S,17R,18R)-7,9,16,18-tetrakis(methoxymethoxy)-8,17-bis(phenylmethoxy)-19,20-dioxa-3,12-diazatricyclo[13.3.1.16,10]icosane.
| Compound Name | (1R,6R,7S,8R,9R,10R,15R,16S,17R,18R)-7,9,16,18-tetrakis(methoxymethoxy)-8,17-bis(phenylmethoxy)-19,20-dioxa-3,12-diazatricyclo[13.3.1.16,10]icosane |
|---|---|
| PubChem CID | 11170100 |
| Molecular Formula | C38H58N2O12 |
| Molecular Weight | 734.88 g/mol |
| Exact Mass | 734.40 |
| IUPAC Name | (1R,6R,7S,8R,9R,10R,15R,16S,17R,18R)-7,9,16,18-tetrakis(methoxymethoxy)-8,17-bis(phenylmethoxy)-19,20-dioxa-3,12-diazatricyclo[13.3.1.16,10]icosane |
| SMILES | COCO[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCOC)[C@H]2CNCC[C@H]3O[C@H](CNCC[C@H]1O2)[C@@H](OCOC)[C@H](OCc1ccccc1)[C@H]3OCOC |
| InChI | InChI=1S/C38H58N2O12/c1-41-23-47-33-29-15-17-39-20-32-36(50-26-44-4)38(46-22-28-13-9-6-10-14-28)34(48-24-42-2)30(52-32)16-18-40-19-31(51-29)35(49-25-43-3)37(33)45-21-27-11-7-5-8-12-27/h5-14,29-40H,15-26H2,1-4H3/t29-,30-,31-,32-,33+,34+,35-,36-,37-,38-/m1/s1 |
| InChIKey | UYMLSIXUZHQMON-JQYMQLFCSA-N |
| XLogP | 2.62 |
| TPSA | 134.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.88 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|