C18H30ClIN4O2S2 — CID 111702623
1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111702623) has the molecular formula C18H30ClIN4O2S2 and a molecular weight of 560.96 g/mol. Its IUPAC name is 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111702623 |
| Molecular Formula | C18H30ClIN4O2S2 |
| Molecular Weight | 560.96 g/mol |
| Exact Mass | 560.05 |
| IUPAC Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1(N2CCOCC2)CCSC1)NCC(O)c1ccc(Cl)s1.I |
| InChI | InChI=1S/C18H29ClN4O2S2.HI/c1-2-20-17(21-11-14(24)15-3-4-16(19)27-15)22-12-18(5-10-26-13-18)23-6-8-25-9-7-23;/h3-4,14,24H,2,5-13H2,1H3,(H2,20,21,22);1H |
| InChIKey | ZGJRHBCCKAYKLX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.96 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|