C21H30N4S — CID 111704032
1-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-methyl-3-(2-thiophen-3-ylpropyl)guanidine (PubChem CID 111704032) has the molecular formula C21H30N4S and a molecular weight of 370.57 g/mol. Its IUPAC name is 1-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-methyl-3-(2-thiophen-3-ylpropyl)guanidine.
| Compound Name | 1-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-methyl-3-(2-thiophen-3-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111704032 |
| Molecular Formula | C21H30N4S |
| Molecular Weight | 370.57 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 1-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-methyl-3-(2-thiophen-3-ylpropyl)guanidine |
| SMILES | C/N=C(/NCCCN1CCc2ccccc2C1)NCC(C)c1ccsc1 |
| InChI | InChI=1S/C21H30N4S/c1-17(20-9-13-26-16-20)14-24-21(22-2)23-10-5-11-25-12-8-18-6-3-4-7-19(18)15-25/h3-4,6-7,9,13,16-17H,5,8,10-12,14-15H2,1-2H3,(H2,22,23,24) |
| InChIKey | CNELIATVWPZHQN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.57 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|