C18H23N3O2S — CID 111704244
methyl 4-[[[N'-methyl-N-(2-thiophen-3-ylpropyl)carbamimidoyl]amino]methyl]benzoate (PubChem CID 111704244) has the molecular formula C18H23N3O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is methyl 4-[[[N'-methyl-N-(2-thiophen-3-ylpropyl)carbamimidoyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[N'-methyl-N-(2-thiophen-3-ylpropyl)carbamimidoyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 111704244 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | methyl 4-[[[N'-methyl-N-(2-thiophen-3-ylpropyl)carbamimidoyl]amino]methyl]benzoate |
| SMILES | C/N=C(/NCc1ccc(C(=O)OC)cc1)NCC(C)c1ccsc1 |
| InChI | InChI=1S/C18H23N3O2S/c1-13(16-8-9-24-12-16)10-20-18(19-2)21-11-14-4-6-15(7-5-14)17(22)23-3/h4-9,12-13H,10-11H2,1-3H3,(H2,19,20,21) |
| InChIKey | XDWMXJTYJWVRBQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|