C15H27IN4O3S2 — CID 111704506
2-methyl-1-(2-morpholin-4-ylsulfonylethyl)-3-(2-thiophen-3-ylpropyl)guanidine;hydroiodide (PubChem CID 111704506) has the molecular formula C15H27IN4O3S2 and a molecular weight of 502.44 g/mol. Its IUPAC name is 2-methyl-1-(2-morpholin-4-ylsulfonylethyl)-3-(2-thiophen-3-ylpropyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-morpholin-4-ylsulfonylethyl)-3-(2-thiophen-3-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111704506 |
| Molecular Formula | C15H27IN4O3S2 |
| Molecular Weight | 502.44 g/mol |
| Exact Mass | 502.06 |
| IUPAC Name | 2-methyl-1-(2-morpholin-4-ylsulfonylethyl)-3-(2-thiophen-3-ylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCS(=O)(=O)N1CCOCC1)NCC(C)c1ccsc1.I |
| InChI | InChI=1S/C15H26N4O3S2.HI/c1-13(14-3-9-23-12-14)11-18-15(16-2)17-4-10-24(20,21)19-5-7-22-8-6-19;/h3,9,12-13H,4-8,10-11H2,1-2H3,(H2,16,17,18);1H |
| InChIKey | KNFYFYTUNXCTCR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.44 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|