C22H31N3O2S — CID 111704557
1-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-2-methyl-3-(2-thiophen-3-ylpropyl)guanidine (PubChem CID 111704557) has the molecular formula C22H31N3O2S and a molecular weight of 401.58 g/mol. Its IUPAC name is 1-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-2-methyl-3-(2-thiophen-3-ylpropyl)guanidine.
| Compound Name | 1-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-2-methyl-3-(2-thiophen-3-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111704557 |
| Molecular Formula | C22H31N3O2S |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 1-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-2-methyl-3-(2-thiophen-3-ylpropyl)guanidine |
| SMILES | C/N=C(\NCC(C)c1ccsc1)NCC1(c2ccc(OC)cc2)CCOCC1 |
| InChI | InChI=1S/C22H31N3O2S/c1-17(18-8-13-28-15-18)14-24-21(23-2)25-16-22(9-11-27-12-10-22)19-4-6-20(26-3)7-5-19/h4-8,13,15,17H,9-12,14,16H2,1-3H3,(H2,23,24,25) |
| InChIKey | BNAHXBPHPFQJQV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|