C36H16Cl8N12 — CID 11170497
(10Z,14Z,19Z)-5,10,15,20-tetrakis(4,6-dichloropyrimidin-5-yl)-5,21,22,23-tetrahydroporphyrin (PubChem CID 11170497) has the molecular formula C36H16Cl8N12 and a molecular weight of 900.23 g/mol. Its IUPAC name is (10Z,14Z,19Z)-5,10,15,20-tetrakis(4,6-dichloropyrimidin-5-yl)-5,21,22,23-tetrahydroporphyrin.
| Compound Name | (10Z,14Z,19Z)-5,10,15,20-tetrakis(4,6-dichloropyrimidin-5-yl)-5,21,22,23-tetrahydroporphyrin |
|---|---|
| PubChem CID | 11170497 |
| Molecular Formula | C36H16Cl8N12 |
| Molecular Weight | 900.23 g/mol |
| Exact Mass | 895.91 |
| IUPAC Name | (10Z,14Z,19Z)-5,10,15,20-tetrakis(4,6-dichloropyrimidin-5-yl)-5,21,22,23-tetrahydroporphyrin |
| SMILES | Clc1ncnc(Cl)c1/C1=C2\C=CC(=N2)/C(c2c(Cl)ncnc2Cl)=c2/cc/c([nH]2)=C(\c2c(Cl)ncnc2Cl)c2ccc([nH]2)C(c2c(Cl)ncnc2Cl)c2ccc1[nH]2 |
| InChI | InChI=1S/C36H16Cl8N12/c37-29-25(30(38)46-9-45-29)21-13-1-2-14(53-13)22(26-31(39)47-10-48-32(26)40)16-5-6-18(55-16)24(28-35(43)51-12-52-36(28)44)20-8-7-19(56-20)23(17-4-3-15(21)54-17)27-33(41)49-11-50-34(27)42/h1-12,21,53-55H/b22-16+,23-19+,24-18+ |
| InChIKey | NDIBCGZWLOJLHY-BOZKLGTBSA-N |
| XLogP | 8.47 |
| TPSA | 162.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 900.23 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |