C18H26IN7O2 — CID 111705064
N-cyclopropyl-2-[3-[[[N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide (PubChem CID 111705064) has the molecular formula C18H26IN7O2 and a molecular weight of 499.36 g/mol. Its IUPAC name is N-cyclopropyl-2-[3-[[[N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide.
| Compound Name | N-cyclopropyl-2-[3-[[[N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111705064 |
| Molecular Formula | C18H26IN7O2 |
| Molecular Weight | 499.36 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | N-cyclopropyl-2-[3-[[[N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(OCC(=O)NC2CC2)c1)NCc1ncnn1C.I |
| InChI | InChI=1S/C18H25N7O2.HI/c1-19-18(21-10-16-22-12-23-25(16)2)20-9-13-4-3-5-15(8-13)27-11-17(26)24-14-6-7-14;/h3-5,8,12,14H,6-7,9-11H2,1-2H3,(H,24,26)(H2,19,20,21);1H |
| InChIKey | KERNTNWTESDZNC-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 105.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.36 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|