C14H27N7 — CID 111705139
2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[(1-propylpyrrolidin-3-yl)methyl]guanidine (PubChem CID 111705139) has the molecular formula C14H27N7 and a molecular weight of 293.42 g/mol. Its IUPAC name is 2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[(1-propylpyrrolidin-3-yl)methyl]guanidine.
| Compound Name | 2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[(1-propylpyrrolidin-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111705139 |
| Molecular Formula | C14H27N7 |
| Molecular Weight | 293.42 g/mol |
| Exact Mass | 293.23 |
| IUPAC Name | 2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[(1-propylpyrrolidin-3-yl)methyl]guanidine |
| SMILES | CCCN1CCC(CN/C(=N/C)NCc2ncnn2C)C1 |
| InChI | InChI=1S/C14H27N7/c1-4-6-21-7-5-12(10-21)8-16-14(15-2)17-9-13-18-11-19-20(13)3/h11-12H,4-10H2,1-3H3,(H2,15,16,17) |
| InChIKey | LZRAYIOQOMNCRZ-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.42 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|