C16H26IN7O — CID 111706542
1-[(2-butoxy-3-pyridinyl)methyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111706542) has the molecular formula C16H26IN7O and a molecular weight of 459.34 g/mol. Its IUPAC name is 1-[(2-butoxy-3-pyridinyl)methyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(2-butoxy-3-pyridinyl)methyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111706542 |
| Molecular Formula | C16H26IN7O |
| Molecular Weight | 459.34 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | 1-[(2-butoxy-3-pyridinyl)methyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCCCOc1ncccc1CN/C(=N/C)NCc1ncnn1C.I |
| InChI | InChI=1S/C16H25N7O.HI/c1-4-5-9-24-15-13(7-6-8-18-15)10-19-16(17-2)20-11-14-21-12-22-23(14)3;/h6-8,12H,4-5,9-11H2,1-3H3,(H2,17,19,20);1H |
| InChIKey | ADRVCSFAKSLMJJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|