C18H28IN7O — CID 111707014
2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[[3-(morpholin-4-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111707014) has the molecular formula C18H28IN7O and a molecular weight of 485.37 g/mol. Its IUPAC name is 2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[[3-(morpholin-4-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[[3-(morpholin-4-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111707014 |
| Molecular Formula | C18H28IN7O |
| Molecular Weight | 485.37 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | 2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[[3-(morpholin-4-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(CN2CCOCC2)c1)NCc1ncnn1C.I |
| InChI | InChI=1S/C18H27N7O.HI/c1-19-18(21-12-17-22-14-23-24(17)2)20-11-15-4-3-5-16(10-15)13-25-6-8-26-9-7-25;/h3-5,10,14H,6-9,11-13H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | MBISBWGOTSOOCL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.37 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|