C13H16ClF2N3O — CID 111708611
2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1-(2-methylprop-2-enyl)guanidine (PubChem CID 111708611) has the molecular formula C13H16ClF2N3O and a molecular weight of 303.74 g/mol. Its IUPAC name is 2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1-(2-methylprop-2-enyl)guanidine.
| Compound Name | 2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1-(2-methylprop-2-enyl)guanidine |
|---|---|
| PubChem CID | 111708611 |
| Molecular Formula | C13H16ClF2N3O |
| Molecular Weight | 303.74 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1-(2-methylprop-2-enyl)guanidine |
| SMILES | C=C(C)CN/C(N)=N/Cc1cc(Cl)ccc1OC(F)F |
| InChI | InChI=1S/C13H16ClF2N3O/c1-8(2)6-18-13(17)19-7-9-5-10(14)3-4-11(9)20-12(15)16/h3-5,12H,1,6-7H2,2H3,(H3,17,18,19) |
| InChIKey | HKDUDGQOLOLSAL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.74 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|