C20H24ClF2IN4O3 — CID 111708720
methyl N-[4-[[[[[5-chloro-2-(difluoromethoxy)phenyl]methylamino]-(ethylamino)methylidene]amino]methyl]phenyl]carbamate;hydroiodide (PubChem CID 111708720) has the molecular formula C20H24ClF2IN4O3 and a molecular weight of 568.79 g/mol. Its IUPAC name is methyl N-[4-[[[[[5-chloro-2-(difluoromethoxy)phenyl]methylamino]-(ethylamino)methylidene]amino]methyl]phenyl]carbamate;hydroiodide.
| Compound Name | methyl N-[4-[[[[[5-chloro-2-(difluoromethoxy)phenyl]methylamino]-(ethylamino)methylidene]amino]methyl]phenyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111708720 |
| Molecular Formula | C20H24ClF2IN4O3 |
| Molecular Weight | 568.79 g/mol |
| Exact Mass | 568.05 |
| IUPAC Name | methyl N-[4-[[[[[5-chloro-2-(difluoromethoxy)phenyl]methylamino]-(ethylamino)methylidene]amino]methyl]phenyl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(NC(=O)OC)cc1)NCc1cc(Cl)ccc1OC(F)F.I |
| InChI | InChI=1S/C20H23ClF2N4O3.HI/c1-3-24-19(25-11-13-4-7-16(8-5-13)27-20(28)29-2)26-12-14-10-15(21)6-9-17(14)30-18(22)23;/h4-10,18H,3,11-12H2,1-2H3,(H,27,28)(H2,24,25,26);1H |
| InChIKey | ILIJPYQACPADPP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.79 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|