About 2-fluoro-1,1-dimethylcyclobutane
2-fluoro-1,1-dimethylcyclobutane (PubChem CID 11170930) has the molecular formula C6H11F
and a molecular weight of 102.15 g/mol. Its IUPAC name is 2-fluoro-1,1-dimethylcyclobutane.
Molecular Properties
| Compound Name | 2-fluoro-1,1-dimethylcyclobutane |
| PubChem CID | 11170930 |
| Molecular Formula | C6H11F |
| Molecular Weight | 102.15 g/mol |
| Exact Mass | 102.08 |
| IUPAC Name | 2-fluoro-1,1-dimethylcyclobutane |
| SMILES | CC1(C)CCC1F |
| InChI | InChI=1S/C6H11F/c1-6(2)4-3-5(6)7/h5H,3-4H2,1-2H3 |
| InChIKey | WWVYMMNXDLZGFP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.15 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-fluoro-1,1-dimethylcyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-1,1-dimethylcyclobutane?
The IUPAC name of 2-fluoro-1,1-dimethylcyclobutane (CID 11170930) is 2-fluoro-1,1-dimethylcyclobutane.
What is the SMILES notation for 2-fluoro-1,1-dimethylcyclobutane?
The canonical SMILES for 2-fluoro-1,1-dimethylcyclobutane is CC1(C)CCC1F.
What is the InChIKey of 2-fluoro-1,1-dimethylcyclobutane?
The InChIKey is WWVYMMNXDLZGFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11F/c1-6(2)4-3-5(6)7/h5H,3-4H2,1-2H3.
What are the key properties of 2-fluoro-1,1-dimethylcyclobutane?
2-fluoro-1,1-dimethylcyclobutane has a molecular weight of 102.15 g/mol, XLogP of 2.14, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-1,1-dimethylcyclobutane is sourced from PubChem (CID 11170930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).