About 2-hydrazinylpropane-1,3-diol
2-hydrazinylpropane-1,3-diol (PubChem CID 11170933) has the molecular formula C3H10N2O2
and a molecular weight of 106.12 g/mol. Its IUPAC name is 2-hydrazinylpropane-1,3-diol.
Molecular Properties
| Compound Name | 2-hydrazinylpropane-1,3-diol |
| PubChem CID | 11170933 |
| Molecular Formula | C3H10N2O2 |
| Molecular Weight | 106.12 g/mol |
| Exact Mass | 106.07 |
| IUPAC Name | 2-hydrazinylpropane-1,3-diol |
| SMILES | NNC(CO)CO |
| InChI | InChI=1S/C3H10N2O2/c4-5-3(1-6)2-7/h3,5-7H,1-2,4H2 |
| InChIKey | WUIYQFDCODJYLD-UHFFFAOYSA-N |
| XLogP | -2.20 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.12 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydrazinylpropane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydrazinylpropane-1,3-diol?
The IUPAC name of 2-hydrazinylpropane-1,3-diol (CID 11170933) is 2-hydrazinylpropane-1,3-diol.
What is the SMILES notation for 2-hydrazinylpropane-1,3-diol?
The canonical SMILES for 2-hydrazinylpropane-1,3-diol is NNC(CO)CO.
What is the InChIKey of 2-hydrazinylpropane-1,3-diol?
The InChIKey is WUIYQFDCODJYLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10N2O2/c4-5-3(1-6)2-7/h3,5-7H,1-2,4H2.
What are the key properties of 2-hydrazinylpropane-1,3-diol?
2-hydrazinylpropane-1,3-diol has a molecular weight of 106.12 g/mol, XLogP of -2.20, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydrazinylpropane-1,3-diol is sourced from PubChem (CID 11170933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).