About 2-(2-aminoethoxy)acetic acid
2-(2-aminoethoxy)acetic acid (PubChem CID 11170956) has the molecular formula C4H9NO3
and a molecular weight of 119.12 g/mol. Its IUPAC name is 2-(2-aminoethoxy)acetic acid.
Molecular Properties
| Compound Name | 2-(2-aminoethoxy)acetic acid |
| PubChem CID | 11170956 |
| Molecular Formula | C4H9NO3 |
| Molecular Weight | 119.12 g/mol |
| Exact Mass | 119.06 |
| IUPAC Name | 2-(2-aminoethoxy)acetic acid |
| SMILES | NCCOCC(=O)O |
| InChI | InChI=1S/C4H9NO3/c5-1-2-8-3-4(6)7/h1-3,5H2,(H,6,7) |
| InChIKey | GNRLUBOJIGSVNT-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.12 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-aminoethoxy)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminoethoxy)acetic acid?
The IUPAC name of 2-(2-aminoethoxy)acetic acid (CID 11170956) is 2-(2-aminoethoxy)acetic acid.
What is the SMILES notation for 2-(2-aminoethoxy)acetic acid?
The canonical SMILES for 2-(2-aminoethoxy)acetic acid is NCCOCC(=O)O.
What is the InChIKey of 2-(2-aminoethoxy)acetic acid?
The InChIKey is GNRLUBOJIGSVNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO3/c5-1-2-8-3-4(6)7/h1-3,5H2,(H,6,7).
What are the key properties of 2-(2-aminoethoxy)acetic acid?
2-(2-aminoethoxy)acetic acid has a molecular weight of 119.12 g/mol, XLogP of -0.95, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoethoxy)acetic acid is sourced from PubChem (CID 11170956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).