C22H39IN4O2 — CID 111710192
N-[3-[[[ethylamino-[(2-methoxy-3,3-dimethylbutyl)amino]methylidene]amino]methyl]phenyl]-2-methylbutanamide;hydroiodide (PubChem CID 111710192) has the molecular formula C22H39IN4O2 and a molecular weight of 518.48 g/mol. Its IUPAC name is N-[3-[[[ethylamino-[(2-methoxy-3,3-dimethylbutyl)amino]methylidene]amino]methyl]phenyl]-2-methylbutanamide;hydroiodide.
| Compound Name | N-[3-[[[ethylamino-[(2-methoxy-3,3-dimethylbutyl)amino]methylidene]amino]methyl]phenyl]-2-methylbutanamide;hydroiodide |
|---|---|
| PubChem CID | 111710192 |
| Molecular Formula | C22H39IN4O2 |
| Molecular Weight | 518.48 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | N-[3-[[[ethylamino-[(2-methoxy-3,3-dimethylbutyl)amino]methylidene]amino]methyl]phenyl]-2-methylbutanamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)C(C)CC)c1)NCC(OC)C(C)(C)C.I |
| InChI | InChI=1S/C22H38N4O2.HI/c1-8-16(3)20(27)26-18-12-10-11-17(13-18)14-24-21(23-9-2)25-15-19(28-7)22(4,5)6;/h10-13,16,19H,8-9,14-15H2,1-7H3,(H,26,27)(H2,23,24,25);1H |
| InChIKey | GEIVMGXGZRLSQA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|