C20H37IN4O — CID 111710350
1-[2-(dimethylamino)-3-phenylpropyl]-3-(2-methoxy-3,3-dimethylbutyl)-2-methylguanidine;hydroiodide (PubChem CID 111710350) has the molecular formula C20H37IN4O and a molecular weight of 476.45 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-3-phenylpropyl]-3-(2-methoxy-3,3-dimethylbutyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(dimethylamino)-3-phenylpropyl]-3-(2-methoxy-3,3-dimethylbutyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111710350 |
| Molecular Formula | C20H37IN4O |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 1-[2-(dimethylamino)-3-phenylpropyl]-3-(2-methoxy-3,3-dimethylbutyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCC(Cc1ccccc1)N(C)C)NCC(OC)C(C)(C)C.I |
| InChI | InChI=1S/C20H36N4O.HI/c1-20(2,3)18(25-7)15-23-19(21-4)22-14-17(24(5)6)13-16-11-9-8-10-12-16;/h8-12,17-18H,13-15H2,1-7H3,(H2,21,22,23);1H |
| InChIKey | NWPOYYNKIVVGLL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|