C18H32IN3O2 — CID 111710854
1-(2-methoxy-3,3-dimethylbutyl)-3-[2-(2-methoxyphenyl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111710854) has the molecular formula C18H32IN3O2 and a molecular weight of 449.38 g/mol. Its IUPAC name is 1-(2-methoxy-3,3-dimethylbutyl)-3-[2-(2-methoxyphenyl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(2-methoxy-3,3-dimethylbutyl)-3-[2-(2-methoxyphenyl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111710854 |
| Molecular Formula | C18H32IN3O2 |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 1-(2-methoxy-3,3-dimethylbutyl)-3-[2-(2-methoxyphenyl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccccc1OC)NCC(OC)C(C)(C)C.I |
| InChI | InChI=1S/C18H31N3O2.HI/c1-18(2,3)16(23-6)13-21-17(19-4)20-12-11-14-9-7-8-10-15(14)22-5;/h7-10,16H,11-13H2,1-6H3,(H2,19,20,21);1H |
| InChIKey | QDRXKKBDWHVRSM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|