About 2-prop-2-enylbutanedioic acid
2-prop-2-enylbutanedioic acid (PubChem CID 11171122) has the molecular formula C7H10O4
and a molecular weight of 158.15 g/mol. Its IUPAC name is 2-prop-2-enylbutanedioic acid.
Molecular Properties
| Compound Name | 2-prop-2-enylbutanedioic acid |
| PubChem CID | 11171122 |
| Molecular Formula | C7H10O4 |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 2-prop-2-enylbutanedioic acid |
| SMILES | C=CCC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C7H10O4/c1-2-3-5(7(10)11)4-6(8)9/h2,5H,1,3-4H2,(H,8,9)(H,10,11) |
| InChIKey | OCXPJMSKLNNYLE-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enylbutanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enylbutanedioic acid?
The IUPAC name of 2-prop-2-enylbutanedioic acid (CID 11171122) is 2-prop-2-enylbutanedioic acid.
What is the SMILES notation for 2-prop-2-enylbutanedioic acid?
The canonical SMILES for 2-prop-2-enylbutanedioic acid is C=CCC(CC(=O)O)C(=O)O.
What is the InChIKey of 2-prop-2-enylbutanedioic acid?
The InChIKey is OCXPJMSKLNNYLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O4/c1-2-3-5(7(10)11)4-6(8)9/h2,5H,1,3-4H2,(H,8,9)(H,10,11).
What are the key properties of 2-prop-2-enylbutanedioic acid?
2-prop-2-enylbutanedioic acid has a molecular weight of 158.15 g/mol, XLogP of 0.74, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enylbutanedioic acid is sourced from PubChem (CID 11171122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).