About 1-phenylpyrrolidin-3-ol
1-phenylpyrrolidin-3-ol (PubChem CID 11171152) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 1-phenylpyrrolidin-3-ol.
Molecular Properties
| Compound Name | 1-phenylpyrrolidin-3-ol |
| PubChem CID | 11171152 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 1-phenylpyrrolidin-3-ol |
| SMILES | OC1CCN(c2ccccc2)C1 |
| InChI | InChI=1S/C10H13NO/c12-10-6-7-11(8-10)9-4-2-1-3-5-9/h1-5,10,12H,6-8H2 |
| InChIKey | CFOXGLLEGVOLKT-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-phenylpyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylpyrrolidin-3-ol?
The IUPAC name of 1-phenylpyrrolidin-3-ol (CID 11171152) is 1-phenylpyrrolidin-3-ol.
What is the SMILES notation for 1-phenylpyrrolidin-3-ol?
The canonical SMILES for 1-phenylpyrrolidin-3-ol is OC1CCN(c2ccccc2)C1.
What is the InChIKey of 1-phenylpyrrolidin-3-ol?
The InChIKey is CFOXGLLEGVOLKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c12-10-6-7-11(8-10)9-4-2-1-3-5-9/h1-5,10,12H,6-8H2.
What are the key properties of 1-phenylpyrrolidin-3-ol?
1-phenylpyrrolidin-3-ol has a molecular weight of 163.22 g/mol, XLogP of 1.26, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpyrrolidin-3-ol is sourced from PubChem (CID 11171152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).