About (1R,4R)-1-(hydroxymethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-one
(1R,4R)-1-(hydroxymethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 11171204) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is (1R,4R)-1-(hydroxymethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-one.
Molecular Properties
| Compound Name | (1R,4R)-1-(hydroxymethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-one |
| PubChem CID | 11171204 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (1R,4R)-1-(hydroxymethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(CO)C(=O)C2 |
| InChI | InChI=1S/C10H16O2/c1-9(2)7-3-4-10(9,6-11)8(12)5-7/h7,11H,3-6H2,1-2H3/t7-,10-/m1/s1 |
| InChIKey | SJTUMRJEPINXFC-GMSGAONNSA-N |
| XLogP | 1.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R,4R)-1-(hydroxymethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,4R)-1-(hydroxymethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-one?
The IUPAC name of (1R,4R)-1-(hydroxymethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-one (CID 11171204) is (1R,4R)-1-(hydroxymethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-one.
What is the SMILES notation for (1R,4R)-1-(hydroxymethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-one?
The canonical SMILES for (1R,4R)-1-(hydroxymethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-one is CC1(C)[C@@H]2CC[C@@]1(CO)C(=O)C2.
What is the InChIKey of (1R,4R)-1-(hydroxymethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-one?
The InChIKey is SJTUMRJEPINXFC-GMSGAONNSA-N. The full InChI is InChI=1S/C10H16O2/c1-9(2)7-3-4-10(9,6-11)8(12)5-7/h7,11H,3-6H2,1-2H3/t7-,10-/m1/s1.
What are the key properties of (1R,4R)-1-(hydroxymethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-one?
(1R,4R)-1-(hydroxymethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-one has a molecular weight of 168.24 g/mol, XLogP of 1.37, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,4R)-1-(hydroxymethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-one is sourced from PubChem (CID 11171204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).