C8H11N3O2 — CID 11171339
5,7-dimethyl-1,3a,7,7a-tetrahydroimidazo[4,5-c]pyridine-4,6-dione (PubChem CID 11171339) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is 5,7-dimethyl-1,3a,7,7a-tetrahydroimidazo[4,5-c]pyridine-4,6-dione.
| Compound Name | 5,7-dimethyl-1,3a,7,7a-tetrahydroimidazo[4,5-c]pyridine-4,6-dione |
|---|---|
| PubChem CID | 11171339 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 5,7-dimethyl-1,3a,7,7a-tetrahydroimidazo[4,5-c]pyridine-4,6-dione |
| SMILES | CC1C(=O)N(C)C(=O)C2N=CNC12 |
| InChI | InChI=1S/C8H11N3O2/c1-4-5-6(10-3-9-5)8(13)11(2)7(4)12/h3-6H,1-2H3,(H,9,10) |
| InChIKey | ZWDZFZSBZCXERU-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|