About (3S,5R)-piperidine-3,5-diamine
(3S,5R)-piperidine-3,5-diamine (PubChem CID 11171447) has the molecular formula C5H13N3
and a molecular weight of 115.18 g/mol. Its IUPAC name is (3S,5R)-piperidine-3,5-diamine.
Molecular Properties
| Compound Name | (3S,5R)-piperidine-3,5-diamine |
| PubChem CID | 11171447 |
| Molecular Formula | C5H13N3 |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.11 |
| IUPAC Name | (3S,5R)-piperidine-3,5-diamine |
| SMILES | N[C@@H]1CNC[C@H](N)C1 |
| InChI | InChI=1S/C5H13N3/c6-4-1-5(7)3-8-2-4/h4-5,8H,1-3,6-7H2/t4-,5+ |
| InChIKey | VMMXQCOKHQCHHD-SYDPRGILSA-N |
| XLogP | -1.37 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S,5R)-piperidine-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5R)-piperidine-3,5-diamine?
The IUPAC name of (3S,5R)-piperidine-3,5-diamine (CID 11171447) is (3S,5R)-piperidine-3,5-diamine.
What is the SMILES notation for (3S,5R)-piperidine-3,5-diamine?
The canonical SMILES for (3S,5R)-piperidine-3,5-diamine is N[C@@H]1CNC[C@H](N)C1.
What is the InChIKey of (3S,5R)-piperidine-3,5-diamine?
The InChIKey is VMMXQCOKHQCHHD-SYDPRGILSA-N. The full InChI is InChI=1S/C5H13N3/c6-4-1-5(7)3-8-2-4/h4-5,8H,1-3,6-7H2/t4-,5+.
What are the key properties of (3S,5R)-piperidine-3,5-diamine?
(3S,5R)-piperidine-3,5-diamine has a molecular weight of 115.18 g/mol, XLogP of -1.37, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5R)-piperidine-3,5-diamine is sourced from PubChem (CID 11171447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).