About 6-hydroperoxy-3,7-dimethyloct-7-en-1-ol
6-hydroperoxy-3,7-dimethyloct-7-en-1-ol (PubChem CID 11171459) has the molecular formula C10H20O3
and a molecular weight of 188.27 g/mol. Its IUPAC name is 6-hydroperoxy-3,7-dimethyloct-7-en-1-ol.
Molecular Properties
| Compound Name | 6-hydroperoxy-3,7-dimethyloct-7-en-1-ol |
| PubChem CID | 11171459 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | 6-hydroperoxy-3,7-dimethyloct-7-en-1-ol |
| SMILES | C=C(C)C(CCC(C)CCO)OO |
| InChI | InChI=1S/C10H20O3/c1-8(2)10(13-12)5-4-9(3)6-7-11/h9-12H,1,4-7H2,2-3H3 |
| InChIKey | BWRCWCXRMMREPA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroperoxy-3,7-dimethyloct-7-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroperoxy-3,7-dimethyloct-7-en-1-ol?
The IUPAC name of 6-hydroperoxy-3,7-dimethyloct-7-en-1-ol (CID 11171459) is 6-hydroperoxy-3,7-dimethyloct-7-en-1-ol.
What is the SMILES notation for 6-hydroperoxy-3,7-dimethyloct-7-en-1-ol?
The canonical SMILES for 6-hydroperoxy-3,7-dimethyloct-7-en-1-ol is C=C(C)C(CCC(C)CCO)OO.
What is the InChIKey of 6-hydroperoxy-3,7-dimethyloct-7-en-1-ol?
The InChIKey is BWRCWCXRMMREPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O3/c1-8(2)10(13-12)5-4-9(3)6-7-11/h9-12H,1,4-7H2,2-3H3.
What are the key properties of 6-hydroperoxy-3,7-dimethyloct-7-en-1-ol?
6-hydroperoxy-3,7-dimethyloct-7-en-1-ol has a molecular weight of 188.27 g/mol, XLogP of 2.22, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroperoxy-3,7-dimethyloct-7-en-1-ol is sourced from PubChem (CID 11171459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).