C12H16N2 — CID 11171464
(4aR)-2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoline (PubChem CID 11171464) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is (4aR)-2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoline.
| Compound Name | (4aR)-2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoline |
|---|---|
| PubChem CID | 11171464 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | (4aR)-2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoline |
| SMILES | c1ccc2c(c1)CC[C@@H]1CNCCN21 |
| InChI | InChI=1S/C12H16N2/c1-2-4-12-10(3-1)5-6-11-9-13-7-8-14(11)12/h1-4,11,13H,5-9H2/t11-/m1/s1 |
| InChIKey | CHIINPDGHUONJZ-LLVKDONJSA-N |
| XLogP | 1.41 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |