C22H46N4O — CID 111715131
1-[4-(3,5-dimethylpiperidin-1-yl)butyl]-3-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]guanidine (PubChem CID 111715131) has the molecular formula C22H46N4O and a molecular weight of 382.64 g/mol. Its IUPAC name is 1-[4-(3,5-dimethylpiperidin-1-yl)butyl]-3-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]guanidine.
| Compound Name | 1-[4-(3,5-dimethylpiperidin-1-yl)butyl]-3-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]guanidine |
|---|---|
| PubChem CID | 111715131 |
| Molecular Formula | C22H46N4O |
| Molecular Weight | 382.64 g/mol |
| Exact Mass | 382.37 |
| IUPAC Name | 1-[4-(3,5-dimethylpiperidin-1-yl)butyl]-3-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]guanidine |
| SMILES | CCN/C(=N\CC(CCO)CC(C)C)NCCCCN1CC(C)CC(C)C1 |
| InChI | InChI=1S/C22H46N4O/c1-6-23-22(25-15-21(9-12-27)13-18(2)3)24-10-7-8-11-26-16-19(4)14-20(5)17-26/h18-21,27H,6-17H2,1-5H3,(H2,23,24,25) |
| InChIKey | SWLWPPGWQDPSON-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.64 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|