C7H14ClNO3 — CID 11171566
(1,3-diethoxy-3-oxopropylidene)azanium chloride (PubChem CID 11171566) has the molecular formula C7H14ClNO3 and a molecular weight of 195.65 g/mol. Its IUPAC name is (1,3-diethoxy-3-oxopropylidene)azanium chloride.
| Compound Name | (1,3-diethoxy-3-oxopropylidene)azanium chloride |
|---|---|
| PubChem CID | 11171566 |
| Molecular Formula | C7H14ClNO3 |
| Molecular Weight | 195.65 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | (1,3-diethoxy-3-oxopropylidene)azanium chloride |
| SMILES | CCOC(=[NH2+])CC(=O)OCC.[Cl-] |
| InChI | InChI=1S/C7H13NO3.ClH/c1-3-10-6(8)5-7(9)11-4-2;/h8H,3-5H2,1-2H3;1H |
| InChIKey | HYMXUYQKXCHWDC-UHFFFAOYSA-N |
| XLogP | -3.86 |
| TPSA | 61.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.65 |
| LogP ≤ 5 | -3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|