C17H37IN4O3S — CID 111715718
1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]guanidine;hydroiodide (PubChem CID 111715718) has the molecular formula C17H37IN4O3S and a molecular weight of 504.48 g/mol. Its IUPAC name is 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111715718 |
| Molecular Formula | C17H37IN4O3S |
| Molecular Weight | 504.48 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(CCO)CC(C)C)NCCN1CCS(=O)(=O)CC1.I |
| InChI | InChI=1S/C17H36N4O3S.HI/c1-4-18-17(20-14-16(5-10-22)13-15(2)3)19-6-7-21-8-11-25(23,24)12-9-21;/h15-16,22H,4-14H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | XTHVRQLMSHUIAZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.48 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|