C16H32F3N3O2 — CID 111715951
2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine (PubChem CID 111715951) has the molecular formula C16H32F3N3O2 and a molecular weight of 355.45 g/mol. Its IUPAC name is 2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine.
| Compound Name | 2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111715951 |
| Molecular Formula | C16H32F3N3O2 |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | 2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
| SMILES | CCN/C(=N\CC(CC)(CC)CCO)NCCCOCC(F)(F)F |
| InChI | InChI=1S/C16H32F3N3O2/c1-4-15(5-2,8-10-23)12-22-14(20-6-3)21-9-7-11-24-13-16(17,18)19/h23H,4-13H2,1-3H3,(H2,20,21,22) |
| InChIKey | SGHJAHGZSFXVGD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|