C14H31N3O2 — CID 111716122
2-(2,2-diethyl-4-hydroxybutyl)-1-(3-ethoxypropyl)guanidine (PubChem CID 111716122) has the molecular formula C14H31N3O2 and a molecular weight of 273.42 g/mol. Its IUPAC name is 2-(2,2-diethyl-4-hydroxybutyl)-1-(3-ethoxypropyl)guanidine.
| Compound Name | 2-(2,2-diethyl-4-hydroxybutyl)-1-(3-ethoxypropyl)guanidine |
|---|---|
| PubChem CID | 111716122 |
| Molecular Formula | C14H31N3O2 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.24 |
| IUPAC Name | 2-(2,2-diethyl-4-hydroxybutyl)-1-(3-ethoxypropyl)guanidine |
| SMILES | CCOCCCN/C(N)=N/CC(CC)(CC)CCO |
| InChI | InChI=1S/C14H31N3O2/c1-4-14(5-2,8-10-18)12-17-13(15)16-9-7-11-19-6-3/h18H,4-12H2,1-3H3,(H3,15,16,17) |
| InChIKey | YTRAVCBJZCULGL-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|