C25H45IN4O2 — CID 111716225
2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-[[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111716225) has the molecular formula C25H45IN4O2 and a molecular weight of 560.57 g/mol. Its IUPAC name is 2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-[[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-[[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111716225 |
| Molecular Formula | C25H45IN4O2 |
| Molecular Weight | 560.57 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | 2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-[[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(CC)(CC)CCO)NCC1CCN(Cc2ccc(OC)cc2)CC1.I |
| InChI | InChI=1S/C25H44N4O2.HI/c1-5-25(6-2,14-17-30)20-28-24(26-7-3)27-18-21-12-15-29(16-13-21)19-22-8-10-23(31-4)11-9-22;/h8-11,21,30H,5-7,12-20H2,1-4H3,(H2,26,27,28);1H |
| InChIKey | CECYMYGYKPKYKD-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.57 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|