C17H32IN3OS — CID 111716615
1-(2,2-diethyl-4-hydroxybutyl)-3-ethyl-2-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111716615) has the molecular formula C17H32IN3OS and a molecular weight of 453.43 g/mol. Its IUPAC name is 1-(2,2-diethyl-4-hydroxybutyl)-3-ethyl-2-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(2,2-diethyl-4-hydroxybutyl)-3-ethyl-2-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111716615 |
| Molecular Formula | C17H32IN3OS |
| Molecular Weight | 453.43 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | 1-(2,2-diethyl-4-hydroxybutyl)-3-ethyl-2-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1sccc1C)NCC(CC)(CC)CCO.I |
| InChI | InChI=1S/C17H31N3OS.HI/c1-5-17(6-2,9-10-21)13-20-16(18-7-3)19-12-15-14(4)8-11-22-15;/h8,11,21H,5-7,9-10,12-13H2,1-4H3,(H2,18,19,20);1H |
| InChIKey | NMFJNGAMYPAWEA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|