About 3-(2-oxopropyl)-3,4-dihydro-1H-quinoxalin-2-one
3-(2-oxopropyl)-3,4-dihydro-1H-quinoxalin-2-one (PubChem CID 11171721) has the molecular formula C11H12N2O2
and a molecular weight of 204.23 g/mol. Its IUPAC name is 3-(2-oxopropyl)-3,4-dihydro-1H-quinoxalin-2-one.
Molecular Properties
| Compound Name | 3-(2-oxopropyl)-3,4-dihydro-1H-quinoxalin-2-one |
| PubChem CID | 11171721 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 3-(2-oxopropyl)-3,4-dihydro-1H-quinoxalin-2-one |
| SMILES | CC(=O)CC1Nc2ccccc2NC1=O |
| InChI | InChI=1S/C11H12N2O2/c1-7(14)6-10-11(15)13-9-5-3-2-4-8(9)12-10/h2-5,10,12H,6H2,1H3,(H,13,15) |
| InChIKey | UXHRGHMSVAOYBX-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-oxopropyl)-3,4-dihydro-1H-quinoxalin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-oxopropyl)-3,4-dihydro-1H-quinoxalin-2-one?
The IUPAC name of 3-(2-oxopropyl)-3,4-dihydro-1H-quinoxalin-2-one (CID 11171721) is 3-(2-oxopropyl)-3,4-dihydro-1H-quinoxalin-2-one.
What is the SMILES notation for 3-(2-oxopropyl)-3,4-dihydro-1H-quinoxalin-2-one?
The canonical SMILES for 3-(2-oxopropyl)-3,4-dihydro-1H-quinoxalin-2-one is CC(=O)CC1Nc2ccccc2NC1=O.
What is the InChIKey of 3-(2-oxopropyl)-3,4-dihydro-1H-quinoxalin-2-one?
The InChIKey is UXHRGHMSVAOYBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2/c1-7(14)6-10-11(15)13-9-5-3-2-4-8(9)12-10/h2-5,10,12H,6H2,1H3,(H,13,15).
What are the key properties of 3-(2-oxopropyl)-3,4-dihydro-1H-quinoxalin-2-one?
3-(2-oxopropyl)-3,4-dihydro-1H-quinoxalin-2-one has a molecular weight of 204.23 g/mol, XLogP of 1.40, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-oxopropyl)-3,4-dihydro-1H-quinoxalin-2-one is sourced from PubChem (CID 11171721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).