C23H35IN4O3 — CID 111718787
1-(3-ethoxy-4-methylpentyl)-3-[[6-(4-methoxyphenoxy)-3-pyridinyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111718787) has the molecular formula C23H35IN4O3 and a molecular weight of 542.46 g/mol. Its IUPAC name is 1-(3-ethoxy-4-methylpentyl)-3-[[6-(4-methoxyphenoxy)-3-pyridinyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(3-ethoxy-4-methylpentyl)-3-[[6-(4-methoxyphenoxy)-3-pyridinyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111718787 |
| Molecular Formula | C23H35IN4O3 |
| Molecular Weight | 542.46 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | 1-(3-ethoxy-4-methylpentyl)-3-[[6-(4-methoxyphenoxy)-3-pyridinyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCOC(CCN/C(=N\C)NCc1ccc(Oc2ccc(OC)cc2)nc1)C(C)C.I |
| InChI | InChI=1S/C23H34N4O3.HI/c1-6-29-21(17(2)3)13-14-25-23(24-4)27-16-18-7-12-22(26-15-18)30-20-10-8-19(28-5)9-11-20;/h7-12,15,17,21H,6,13-14,16H2,1-5H3,(H2,24,25,27);1H |
| InChIKey | BGSALEGWTBLTRO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|