C23H31N5 — CID 111719763
1-[3-[benzyl(methyl)amino]butyl]-3-(1H-indol-2-ylmethyl)-2-methylguanidine (PubChem CID 111719763) has the molecular formula C23H31N5 and a molecular weight of 377.54 g/mol. Its IUPAC name is 1-[3-[benzyl(methyl)amino]butyl]-3-(1H-indol-2-ylmethyl)-2-methylguanidine.
| Compound Name | 1-[3-[benzyl(methyl)amino]butyl]-3-(1H-indol-2-ylmethyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111719763 |
| Molecular Formula | C23H31N5 |
| Molecular Weight | 377.54 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | 1-[3-[benzyl(methyl)amino]butyl]-3-(1H-indol-2-ylmethyl)-2-methylguanidine |
| SMILES | C/N=C(\NCCC(C)N(C)Cc1ccccc1)NCc1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C23H31N5/c1-18(28(3)17-19-9-5-4-6-10-19)13-14-25-23(24-2)26-16-21-15-20-11-7-8-12-22(20)27-21/h4-12,15,18,27H,13-14,16-17H2,1-3H3,(H2,24,25,26) |
| InChIKey | BHINXHNOLDXZQB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.54 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|