C19H35IN4O2S — CID 111719881
2-[3-[benzyl(methyl)amino]butyl]-1-ethyl-3-(2-ethylsulfonylethyl)guanidine;hydroiodide (PubChem CID 111719881) has the molecular formula C19H35IN4O2S and a molecular weight of 510.49 g/mol. Its IUPAC name is 2-[3-[benzyl(methyl)amino]butyl]-1-ethyl-3-(2-ethylsulfonylethyl)guanidine;hydroiodide.
| Compound Name | 2-[3-[benzyl(methyl)amino]butyl]-1-ethyl-3-(2-ethylsulfonylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111719881 |
| Molecular Formula | C19H35IN4O2S |
| Molecular Weight | 510.49 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | 2-[3-[benzyl(methyl)amino]butyl]-1-ethyl-3-(2-ethylsulfonylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCC(C)N(C)Cc1ccccc1)NCCS(=O)(=O)CC.I |
| InChI | InChI=1S/C19H34N4O2S.HI/c1-5-20-19(22-14-15-26(24,25)6-2)21-13-12-17(3)23(4)16-18-10-8-7-9-11-18;/h7-11,17H,5-6,12-16H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | DARBDDPYGXDYMN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.49 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|